C21H28Cl2Zr-2 — CID 173129694
dichloro(propan-2-ylidene)zirconium;bis(4,5,6,7-tetrahydro-1H-inden-1-ide) (PubChem CID 173129694) has the molecular formula C21H28Cl2Zr-2 and a molecular weight of 442.59 g/mol. Its IUPAC name is dichloro(propan-2-ylidene)zirconium;bis(4,5,6,7-tetrahydro-1H-inden-1-ide).
| Compound Name | dichloro(propan-2-ylidene)zirconium;bis(4,5,6,7-tetrahydro-1H-inden-1-ide) |
|---|---|
| PubChem CID | 173129694 |
| Molecular Formula | C21H28Cl2Zr-2 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | dichloro(propan-2-ylidene)zirconium;bis(4,5,6,7-tetrahydro-1H-inden-1-ide) |
| SMILES | CC(C)=[Zr](Cl)Cl.c1cc2c([cH-]1)CCCC2.c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/2C9H11.C3H6.2ClH.Zr/c2*1-2-5-9-7-3-6-8(9)4-1;1-3-2;;;/h2*3,6-7H,1-2,4-5H2;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | XOUISENIIUEYRX-UHFFFAOYSA-L |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|