C11H17O2Zr — CID 88655285
methanolate;4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(3+) (PubChem CID 88655285) has the molecular formula C11H17O2Zr and a molecular weight of 272.48 g/mol. Its IUPAC name is methanolate;4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(3+).
| Compound Name | methanolate;4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(3+) |
|---|---|
| PubChem CID | 88655285 |
| Molecular Formula | C11H17O2Zr |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | methanolate;4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(3+) |
| SMILES | C[O-].C[O-].[Zr+3].c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/C9H11.2CH3O.Zr/c1-2-5-9-7-3-6-8(9)4-1;2*1-2;/h3,6-7H,1-2,4-5H2;2*1H3;/q3*-1;+3 |
| InChIKey | JVRSMYBJECUCGS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|