C9H11Br3Zr — CID 162221677
4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(4+);tribromide (PubChem CID 162221677) has the molecular formula C9H11Br3Zr and a molecular weight of 450.12 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(4+);tribromide.
| Compound Name | 4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(4+);tribromide |
|---|---|
| PubChem CID | 162221677 |
| Molecular Formula | C9H11Br3Zr |
| Molecular Weight | 450.12 g/mol |
| Exact Mass | 445.75 |
| IUPAC Name | 4,5,6,7-tetrahydro-1H-inden-1-ide;zirconium(4+);tribromide |
| SMILES | [Br-].[Br-].[Br-].[Zr+4].c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/C9H11.3BrH.Zr/c1-2-5-9-7-3-6-8(9)4-1;;;;/h3,6-7H,1-2,4-5H2;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | JZSWMJNFIMVDBS-UHFFFAOYSA-K |
| XLogP | -6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.12 |
| LogP ≤ 5 | -6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|