C18H22Hf+2 — CID 22633752
hafnium(4+);bis(4,5,6,7-tetrahydro-1H-inden-1-ide) (PubChem CID 22633752) has the molecular formula C18H22Hf+2 and a molecular weight of 416.86 g/mol. Its IUPAC name is hafnium(4+);bis(4,5,6,7-tetrahydro-1H-inden-1-ide).
| Compound Name | hafnium(4+);bis(4,5,6,7-tetrahydro-1H-inden-1-ide) |
|---|---|
| PubChem CID | 22633752 |
| Molecular Formula | C18H22Hf+2 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | hafnium(4+);bis(4,5,6,7-tetrahydro-1H-inden-1-ide) |
| SMILES | [Hf+4].c1cc2c([cH-]1)CCCC2.c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/2C9H11.Hf/c2*1-2-5-9-7-3-6-8(9)4-1;/h2*3,6-7H,1-2,4-5H2;/q2*-1;+4 |
| InChIKey | MKZCPUKCPNUERX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|