C43H32Zr — CID 173284031
9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-2,7-diphenyl-9H-fluorene;zirconium (PubChem CID 173284031) has the molecular formula C43H32Zr and a molecular weight of 639.95 g/mol. Its IUPAC name is 9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-2,7-diphenyl-9H-fluorene;zirconium.
| Compound Name | 9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-2,7-diphenyl-9H-fluorene;zirconium |
|---|---|
| PubChem CID | 173284031 |
| Molecular Formula | C43H32Zr |
| Molecular Weight | 639.95 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | 9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-2,7-diphenyl-9H-fluorene;zirconium |
| SMILES | C1=CCC(C(c2ccccc2)(c2ccccc2)C2c3cc(-c4ccccc4)ccc3-c3ccc(-c4ccccc4)cc32)=C1.[Zr] |
| InChI | InChI=1S/C43H32.Zr/c1-5-15-31(16-6-1)33-25-27-38-39-28-26-34(32-17-7-2-8-18-32)30-41(39)42(40(38)29-33)43(37-23-13-14-24-37,35-19-9-3-10-20-35)36-21-11-4-12-22-36;/h1-23,25-30,42H,24H2; |
| InChIKey | MHKQZZDUDGKWHB-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.95 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |