C31H22Br2 — CID 22358360
2,7-dibromo-9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-9H-fluorene (PubChem CID 22358360) has the molecular formula C31H22Br2 and a molecular weight of 554.33 g/mol. Its IUPAC name is 2,7-dibromo-9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-9H-fluorene.
| Compound Name | 2,7-dibromo-9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-9H-fluorene |
|---|---|
| PubChem CID | 22358360 |
| Molecular Formula | C31H22Br2 |
| Molecular Weight | 554.33 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | 2,7-dibromo-9-[cyclopenta-1,3-dien-1-yl(diphenyl)methyl]-9H-fluorene |
| SMILES | Brc1ccc2c(c1)C(C(C1=CC=CC1)(c1ccccc1)c1ccccc1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C31H22Br2/c32-24-15-17-26-27-18-16-25(33)20-29(27)30(28(26)19-24)31(23-13-7-8-14-23,21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-13,15-20,30H,14H2 |
| InChIKey | HVOKUYAQXAXXRQ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.33 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |