C33H36 — CID 57245505
9-(2-cyclopenta-1,3-dien-1-ylpropan-2-yl)-2,7-bis(hex-1-ynyl)-9H-fluorene (PubChem CID 57245505) has the molecular formula C33H36 and a molecular weight of 432.65 g/mol. Its IUPAC name is 9-(2-cyclopenta-1,3-dien-1-ylpropan-2-yl)-2,7-bis(hex-1-ynyl)-9H-fluorene.
| Compound Name | 9-(2-cyclopenta-1,3-dien-1-ylpropan-2-yl)-2,7-bis(hex-1-ynyl)-9H-fluorene |
|---|---|
| PubChem CID | 57245505 |
| Molecular Formula | C33H36 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 9-(2-cyclopenta-1,3-dien-1-ylpropan-2-yl)-2,7-bis(hex-1-ynyl)-9H-fluorene |
| SMILES | CCCCC#Cc1ccc2c(c1)C(C(C)(C)C1=CC=CC1)c1cc(C#CCCCC)ccc1-2 |
| InChI | InChI=1S/C33H36/c1-5-7-9-11-15-25-19-21-28-29-22-20-26(16-12-10-8-6-2)24-31(29)32(30(28)23-25)33(3,4)27-17-13-14-18-27/h13-14,17,19-24,32H,5-10,18H2,1-4H3 |
| InChIKey | DTGVCJWSWJMPJI-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|