About 2-anthracen-1-ylpentanal
2-anthracen-1-ylpentanal (PubChem CID 173287359) has the molecular formula C19H18O
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-anthracen-1-ylpentanal.
Molecular Properties
| Compound Name | 2-anthracen-1-ylpentanal |
| PubChem CID | 173287359 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-anthracen-1-ylpentanal |
| SMILES | CCCC(C=O)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C19H18O/c1-2-6-17(13-20)18-10-5-9-16-11-14-7-3-4-8-15(14)12-19(16)18/h3-5,7-13,17H,2,6H2,1H3 |
| InChIKey | JOBMMFIPZHDPRH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-anthracen-1-ylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anthracen-1-ylpentanal?
The IUPAC name of 2-anthracen-1-ylpentanal (CID 173287359) is 2-anthracen-1-ylpentanal.
What is the SMILES notation for 2-anthracen-1-ylpentanal?
The canonical SMILES for 2-anthracen-1-ylpentanal is CCCC(C=O)c1cccc2cc3ccccc3cc12.
What is the InChIKey of 2-anthracen-1-ylpentanal?
The InChIKey is JOBMMFIPZHDPRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O/c1-2-6-17(13-20)18-10-5-9-16-11-14-7-3-4-8-15(14)12-19(16)18/h3-5,7-13,17H,2,6H2,1H3.
What are the key properties of 2-anthracen-1-ylpentanal?
2-anthracen-1-ylpentanal has a molecular weight of 262.35 g/mol, XLogP of 5.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anthracen-1-ylpentanal is sourced from PubChem (CID 173287359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).