About 1-penta-1,4-dien-3-ylanthracene
1-penta-1,4-dien-3-ylanthracene (PubChem CID 21275728) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-penta-1,4-dien-3-ylanthracene.
Molecular Properties
| Compound Name | 1-penta-1,4-dien-3-ylanthracene |
| PubChem CID | 21275728 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-penta-1,4-dien-3-ylanthracene |
| SMILES | C=CC(C=C)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C19H16/c1-3-14(4-2)18-11-7-10-17-12-15-8-5-6-9-16(15)13-19(17)18/h3-14H,1-2H2 |
| InChIKey | PSFBNTVMPXXFKD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-penta-1,4-dien-3-ylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-penta-1,4-dien-3-ylanthracene?
The IUPAC name of 1-penta-1,4-dien-3-ylanthracene (CID 21275728) is 1-penta-1,4-dien-3-ylanthracene.
What is the SMILES notation for 1-penta-1,4-dien-3-ylanthracene?
The canonical SMILES for 1-penta-1,4-dien-3-ylanthracene is C=CC(C=C)c1cccc2cc3ccccc3cc12.
What is the InChIKey of 1-penta-1,4-dien-3-ylanthracene?
The InChIKey is PSFBNTVMPXXFKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16/c1-3-14(4-2)18-11-7-10-17-12-15-8-5-6-9-16(15)13-19(17)18/h3-14H,1-2H2.
What are the key properties of 1-penta-1,4-dien-3-ylanthracene?
1-penta-1,4-dien-3-ylanthracene has a molecular weight of 244.34 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-penta-1,4-dien-3-ylanthracene is sourced from PubChem (CID 21275728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).