About 2-anthracen-1-ylpropanal
2-anthracen-1-ylpropanal (PubChem CID 123532907) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-anthracen-1-ylpropanal.
Molecular Properties
| Compound Name | 2-anthracen-1-ylpropanal |
| PubChem CID | 123532907 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-anthracen-1-ylpropanal |
| SMILES | CC(C=O)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C17H14O/c1-12(11-18)16-8-4-7-15-9-13-5-2-3-6-14(13)10-17(15)16/h2-12H,1H3 |
| InChIKey | QTCSCISBHBKOHI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-anthracen-1-ylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anthracen-1-ylpropanal?
The IUPAC name of 2-anthracen-1-ylpropanal (CID 123532907) is 2-anthracen-1-ylpropanal.
What is the SMILES notation for 2-anthracen-1-ylpropanal?
The canonical SMILES for 2-anthracen-1-ylpropanal is CC(C=O)c1cccc2cc3ccccc3cc12.
What is the InChIKey of 2-anthracen-1-ylpropanal?
The InChIKey is QTCSCISBHBKOHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O/c1-12(11-18)16-8-4-7-15-9-13-5-2-3-6-14(13)10-17(15)16/h2-12H,1H3.
What are the key properties of 2-anthracen-1-ylpropanal?
2-anthracen-1-ylpropanal has a molecular weight of 234.30 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anthracen-1-ylpropanal is sourced from PubChem (CID 123532907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).