About ethyl N-hydroxypentanimidate
ethyl N-hydroxypentanimidate (PubChem CID 173290814) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is ethyl N-hydroxypentanimidate.
Molecular Properties
| Compound Name | ethyl N-hydroxypentanimidate |
| PubChem CID | 173290814 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | ethyl N-hydroxypentanimidate |
| SMILES | CCCCC(=NO)OCC |
| InChI | InChI=1S/C7H15NO2/c1-3-5-6-7(8-9)10-4-2/h9H,3-6H2,1-2H3 |
| InChIKey | NWIVLDYBRUTKKV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-hydroxypentanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-hydroxypentanimidate?
The IUPAC name of ethyl N-hydroxypentanimidate (CID 173290814) is ethyl N-hydroxypentanimidate.
What is the SMILES notation for ethyl N-hydroxypentanimidate?
The canonical SMILES for ethyl N-hydroxypentanimidate is CCCCC(=NO)OCC.
What is the InChIKey of ethyl N-hydroxypentanimidate?
The InChIKey is NWIVLDYBRUTKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-3-5-6-7(8-9)10-4-2/h9H,3-6H2,1-2H3.
What are the key properties of ethyl N-hydroxypentanimidate?
ethyl N-hydroxypentanimidate has a molecular weight of 145.20 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-hydroxypentanimidate is sourced from PubChem (CID 173290814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).