About methyl N-methylpentanimidate
methyl N-methylpentanimidate (PubChem CID 89172529) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is methyl N-methylpentanimidate.
Molecular Properties
| Compound Name | methyl N-methylpentanimidate |
| PubChem CID | 89172529 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | methyl N-methylpentanimidate |
| SMILES | CCCC/C(=N/C)OC |
| InChI | InChI=1S/C7H15NO/c1-4-5-6-7(8-2)9-3/h4-6H2,1-3H3/b8-7- |
| InChIKey | CUOWHYGWWHFMQV-FPLPWBNLSA-N |
| XLogP | 1.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-methylpentanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-methylpentanimidate?
The IUPAC name of methyl N-methylpentanimidate (CID 89172529) is methyl N-methylpentanimidate.
What is the SMILES notation for methyl N-methylpentanimidate?
The canonical SMILES for methyl N-methylpentanimidate is CCCC/C(=N/C)OC.
What is the InChIKey of methyl N-methylpentanimidate?
The InChIKey is CUOWHYGWWHFMQV-FPLPWBNLSA-N. The full InChI is InChI=1S/C7H15NO/c1-4-5-6-7(8-2)9-3/h4-6H2,1-3H3/b8-7-.
What are the key properties of methyl N-methylpentanimidate?
methyl N-methylpentanimidate has a molecular weight of 129.20 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-methylpentanimidate is sourced from PubChem (CID 89172529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).