C10H5Cl3OS — CID 173291739
3-chloro-4-(2,3-dichlorophenoxy)thiophene (PubChem CID 173291739) has the molecular formula C10H5Cl3OS and a molecular weight of 279.57 g/mol. Its IUPAC name is 3-chloro-4-(2,3-dichlorophenoxy)thiophene.
| Compound Name | 3-chloro-4-(2,3-dichlorophenoxy)thiophene |
|---|---|
| PubChem CID | 173291739 |
| Molecular Formula | C10H5Cl3OS |
| Molecular Weight | 279.57 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | 3-chloro-4-(2,3-dichlorophenoxy)thiophene |
| SMILES | Clc1cscc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H5Cl3OS/c11-6-2-1-3-8(10(6)13)14-9-5-15-4-7(9)12/h1-5H |
| InChIKey | VWOQUNXOBXLCOY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |