C14H12F10 — CID 173293488
1-(2-methylpropyl)-2,4-bis(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 173293488) has the molecular formula C14H12F10 and a molecular weight of 370.23 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2,4-bis(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-(2-methylpropyl)-2,4-bis(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 173293488 |
| Molecular Formula | C14H12F10 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-(2-methylpropyl)-2,4-bis(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | CC(C)Cc1ccc(C(F)(F)C(F)(F)F)cc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F10/c1-7(2)5-8-3-4-9(11(15,16)13(19,20)21)6-10(8)12(17,18)14(22,23)24/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | CXOHOTKKQPNOTD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|