C22H37N3O5 — CID 173295836
tert-butyl N-[(9Z,12E)-6-hydroxy-12,14,14-trimethyl-5,16-dioxo-1,4-diazacyclohexadeca-9,12-dien-7-yl]carbamate (PubChem CID 173295836) has the molecular formula C22H37N3O5 and a molecular weight of 423.55 g/mol. Its IUPAC name is tert-butyl N-[(9Z,12E)-6-hydroxy-12,14,14-trimethyl-5,16-dioxo-1,4-diazacyclohexadeca-9,12-dien-7-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z,12E)-6-hydroxy-12,14,14-trimethyl-5,16-dioxo-1,4-diazacyclohexadeca-9,12-dien-7-yl]carbamate |
|---|---|
| PubChem CID | 173295836 |
| Molecular Formula | C22H37N3O5 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | tert-butyl N-[(9Z,12E)-6-hydroxy-12,14,14-trimethyl-5,16-dioxo-1,4-diazacyclohexadeca-9,12-dien-7-yl]carbamate |
| SMILES | C/C1=C\C(C)(C)CC(=O)NCCNC(=O)C(O)C(NC(=O)OC(C)(C)C)C/C=C\C1 |
| InChI | InChI=1S/C22H37N3O5/c1-15-9-7-8-10-16(25-20(29)30-21(2,3)4)18(27)19(28)24-12-11-23-17(26)14-22(5,6)13-15/h7-8,13,16,18,27H,9-12,14H2,1-6H3,(H,23,26)(H,24,28)(H,25,29)/b8-7-,15-13+ |
| InChIKey | IUNVSVITRVMFAG-LTUQJDJGSA-N |
| XLogP | 2.19 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|