C25H25N3NaO4 — CID 173297527
CID 173297527 (PubChem CID 173297527) has the molecular formula C25H25N3NaO4 and a molecular weight of 454.48 g/mol.
| Compound Name | CID 173297527 |
|---|---|
| PubChem CID | 173297527 |
| Molecular Formula | C25H25N3NaO4 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | — |
| SMILES | CN1[C@H](C(=O)O)[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)NCc1cccc2ccccc12.[Na] |
| InChI | InChI=1S/C25H25N3O4.Na/c1-28-21(22(28)25(31)32)24(30)27-20(14-16-8-3-2-4-9-16)23(29)26-15-18-12-7-11-17-10-5-6-13-19(17)18;/h2-13,20-22H,14-15H2,1H3,(H,26,29)(H,27,30)(H,31,32);/t20-,21-,22-,28?;/m0./s1 |
| InChIKey | XVAGUCNDIDBGSP-KNXIGAKDSA-N |
| XLogP | 1.57 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|