C25H52 — CID 173297835
2-methyl-4,4,5,5,6-pentapropylnonane (PubChem CID 173297835) has the molecular formula C25H52 and a molecular weight of 352.69 g/mol. Its IUPAC name is 2-methyl-4,4,5,5,6-pentapropylnonane.
| Compound Name | 2-methyl-4,4,5,5,6-pentapropylnonane |
|---|---|
| PubChem CID | 173297835 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 2-methyl-4,4,5,5,6-pentapropylnonane |
| SMILES | CCCC(CCC)C(CCC)(CCC)C(CCC)(CCC)CC(C)C |
| InChI | InChI=1S/C25H52/c1-9-15-23(16-10-2)25(19-13-5,20-14-6)24(17-11-3,18-12-4)21-22(7)8/h22-23H,9-21H2,1-8H3 |
| InChIKey | GJPCFEQXXOEAMC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |