1-hydroxy-2-phenylguanidine;nitric acid

C7H10N4O4 — CID 173298305

IUPAC1-hydroxy-2-phenylguanidine;nitric acid
SMILESN/C(=N\c1ccccc1)NO.O=[N+]([O-])O
InChIInChI=1S/C7H9N3O.HNO3/c8-7(10-11)9-6-4-2-1-3-5-6;2-1(3)4/h1-5,11H,(H3,8,9,10);(H,2,3,4)
InChIKeyWKUIVQGGCGVJIT-UHFFFAOYSA-N
MW214.18 g/mol
LogP0.26
Rot. Bonds1

About 1-hydroxy-2-phenylguanidine;nitric acid

1-hydroxy-2-phenylguanidine;nitric acid (PubChem CID 173298305) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 1-hydroxy-2-phenylguanidine;nitric acid.

Molecular Properties

Compound Name1-hydroxy-2-phenylguanidine;nitric acid
PubChem CID173298305
Molecular FormulaC7H10N4O4
Molecular Weight214.18 g/mol
Exact Mass214.07
IUPAC Name1-hydroxy-2-phenylguanidine;nitric acid
SMILESN/C(=N\c1ccccc1)NO.O=[N+]([O-])O
InChIInChI=1S/C7H9N3O.HNO3/c8-7(10-11)9-6-4-2-1-3-5-6;2-1(3)4/h1-5,11H,(H3,8,9,10);(H,2,3,4)
InChIKeyWKUIVQGGCGVJIT-UHFFFAOYSA-N
XLogP0.26
TPSA134.01 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.18
LogP ≤ 50.26
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-hydroxy-2-phenylguanidine;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxy-2-phenylguanidine;nitric acid?
The IUPAC name of 1-hydroxy-2-phenylguanidine;nitric acid (CID 173298305) is 1-hydroxy-2-phenylguanidine;nitric acid.
What is the SMILES notation for 1-hydroxy-2-phenylguanidine;nitric acid?
The canonical SMILES for 1-hydroxy-2-phenylguanidine;nitric acid is N/C(=N\c1ccccc1)NO.O=[N+]([O-])O.
What is the InChIKey of 1-hydroxy-2-phenylguanidine;nitric acid?
The InChIKey is WKUIVQGGCGVJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O.HNO3/c8-7(10-11)9-6-4-2-1-3-5-6;2-1(3)4/h1-5,11H,(H3,8,9,10);(H,2,3,4).
What are the key properties of 1-hydroxy-2-phenylguanidine;nitric acid?
1-hydroxy-2-phenylguanidine;nitric acid has a molecular weight of 214.18 g/mol, XLogP of 0.26, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-phenylguanidine;nitric acid is sourced from PubChem (CID 173298305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).