About 2-nitro-N'-phenylethanimidamide
2-nitro-N'-phenylethanimidamide (PubChem CID 91150003) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-nitro-N'-phenylethanimidamide.
Molecular Properties
| Compound Name | 2-nitro-N'-phenylethanimidamide |
| PubChem CID | 91150003 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-nitro-N'-phenylethanimidamide |
| SMILES | N/C(C[N+](=O)[O-])=N/c1ccccc1 |
| InChI | InChI=1S/C8H9N3O2/c9-8(6-11(12)13)10-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | ATQZFGISKHMCLH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-N'-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-N'-phenylethanimidamide?
The IUPAC name of 2-nitro-N'-phenylethanimidamide (CID 91150003) is 2-nitro-N'-phenylethanimidamide.
What is the SMILES notation for 2-nitro-N'-phenylethanimidamide?
The canonical SMILES for 2-nitro-N'-phenylethanimidamide is N/C(C[N+](=O)[O-])=N/c1ccccc1.
What is the InChIKey of 2-nitro-N'-phenylethanimidamide?
The InChIKey is ATQZFGISKHMCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c9-8(6-11(12)13)10-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10).
What are the key properties of 2-nitro-N'-phenylethanimidamide?
2-nitro-N'-phenylethanimidamide has a molecular weight of 179.18 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-N'-phenylethanimidamide is sourced from PubChem (CID 91150003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).