C23H24F3N3O4 — CID 173299381
[(Z)-but-2-en-2-yl] N-[4-[[2-(3,4-difluorophenoxy)-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]carbamate (PubChem CID 173299381) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is [(Z)-but-2-en-2-yl] N-[4-[[2-(3,4-difluorophenoxy)-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]carbamate.
| Compound Name | [(Z)-but-2-en-2-yl] N-[4-[[2-(3,4-difluorophenoxy)-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 173299381 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(Z)-but-2-en-2-yl] N-[4-[[2-(3,4-difluorophenoxy)-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]carbamate |
| SMILES | C/C=C(/C)OC(=O)NC1CCC(NC(=O)c2cc(F)cnc2Oc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C23H24F3N3O4/c1-3-13(2)32-23(31)29-16-6-4-15(5-7-16)28-21(30)18-10-14(24)12-27-22(18)33-17-8-9-19(25)20(26)11-17/h3,8-12,15-16H,4-7H2,1-2H3,(H,28,30)(H,29,31)/b13-3- |
| InChIKey | UMRVEWNMSHVEBG-DXNYSGJVSA-N |
| XLogP | 4.98 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|