C18H24INS — CID 173300657
3-oct-2-en-3-yl-2-prop-1-enylthieno[2,3-b]pyridine;hydroiodide (PubChem CID 173300657) has the molecular formula C18H24INS and a molecular weight of 413.37 g/mol. Its IUPAC name is 3-oct-2-en-3-yl-2-prop-1-enylthieno[2,3-b]pyridine;hydroiodide.
| Compound Name | 3-oct-2-en-3-yl-2-prop-1-enylthieno[2,3-b]pyridine;hydroiodide |
|---|---|
| PubChem CID | 173300657 |
| Molecular Formula | C18H24INS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-oct-2-en-3-yl-2-prop-1-enylthieno[2,3-b]pyridine;hydroiodide |
| SMILES | CC=Cc1sc2ncccc2c1C(=CC)CCCCC.I |
| InChI | InChI=1S/C18H23NS.HI/c1-4-7-8-11-14(6-3)17-15-12-9-13-19-18(15)20-16(17)10-5-2;/h5-6,9-10,12-13H,4,7-8,11H2,1-3H3;1H |
| InChIKey | ZNCRZFLHKUDKTB-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|