C19H21N3 — CID 59785202
2-[(E)-1-phenylhept-1-en-2-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 59785202) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-[(E)-1-phenylhept-1-en-2-yl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[(E)-1-phenylhept-1-en-2-yl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 59785202 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[(E)-1-phenylhept-1-en-2-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | CCCCC/C(=C\c1ccccc1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C19H21N3/c1-2-3-5-11-16(14-15-9-6-4-7-10-15)18-21-17-12-8-13-20-19(17)22-18/h4,6-10,12-14H,2-3,5,11H2,1H3,(H,20,21,22)/b16-14+ |
| InChIKey | PZOQGDWVHAJWRC-JQIJEIRASA-N |
| XLogP | 5.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|