C23H34N2O4 — CID 173301574
tert-butyl N-[(2S)-1-[[(1S)-1-cyclohexyl-2-oxoethyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 173301574) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(1S)-1-cyclohexyl-2-oxoethyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(1S)-1-cyclohexyl-2-oxoethyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 173301574 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(1S)-1-cyclohexyl-2-oxoethyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1ccccc1C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](C=O)C1CCCCC1 |
| InChI | InChI=1S/C23H34N2O4/c1-16-10-8-9-13-18(16)14-19(25-22(28)29-23(2,3)4)21(27)24-20(15-26)17-11-6-5-7-12-17/h8-10,13,15,17,19-20H,5-7,11-12,14H2,1-4H3,(H,24,27)(H,25,28)/t19-,20+/m0/s1 |
| InChIKey | SIGCHQGRMUGOCU-VQTJNVASSA-N |
| XLogP | 3.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|