C22H40 — CID 173302117
2,4,4-trimethyl-6-(2,2,4-trimethylpent-3-enyl)undeca-1,6-diene (PubChem CID 173302117) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 2,4,4-trimethyl-6-(2,2,4-trimethylpent-3-enyl)undeca-1,6-diene.
| Compound Name | 2,4,4-trimethyl-6-(2,2,4-trimethylpent-3-enyl)undeca-1,6-diene |
|---|---|
| PubChem CID | 173302117 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 2,4,4-trimethyl-6-(2,2,4-trimethylpent-3-enyl)undeca-1,6-diene |
| SMILES | C=C(C)CC(C)(C)CC(=CCCCC)CC(C)(C)C=C(C)C |
| InChI | InChI=1S/C22H40/c1-10-11-12-13-20(16-21(6,7)14-18(2)3)17-22(8,9)15-19(4)5/h13,15H,2,10-12,14,16-17H2,1,3-9H3 |
| InChIKey | VTPAVJGRALDRNR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|