C30H24F6N2O3 — CID 173305962
1-[(3R)-3-benzyl-4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-4-phenylbut-2-ene-1,4-dione (PubChem CID 173305962) has the molecular formula C30H24F6N2O3 and a molecular weight of 574.52 g/mol. Its IUPAC name is 1-[(3R)-3-benzyl-4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-4-phenylbut-2-ene-1,4-dione.
| Compound Name | 1-[(3R)-3-benzyl-4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-4-phenylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 173305962 |
| Molecular Formula | C30H24F6N2O3 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 1-[(3R)-3-benzyl-4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-4-phenylbut-2-ene-1,4-dione |
| SMILES | O=C(C=CC(=O)N1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](Cc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C30H24F6N2O3/c31-29(32,33)23-16-22(17-24(18-23)30(34,35)36)28(41)38-14-13-37(19-25(38)15-20-7-3-1-4-8-20)27(40)12-11-26(39)21-9-5-2-6-10-21/h1-12,16-18,25H,13-15,19H2/t25-/m1/s1 |
| InChIKey | FVCXNANFLLLRJE-RUZDIDTESA-N |
| XLogP | 6.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|