C30H28ClF3N4O2 — CID 67596923
(E)-1-[4-[3-amino-5-(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one;hydrochloride (PubChem CID 67596923) has the molecular formula C30H28ClF3N4O2 and a molecular weight of 569.03 g/mol. Its IUPAC name is (E)-1-[4-[3-amino-5-(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[4-[3-amino-5-(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 67596923 |
| Molecular Formula | C30H28ClF3N4O2 |
| Molecular Weight | 569.03 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (E)-1-[4-[3-amino-5-(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one;hydrochloride |
| SMILES | Cl.Nc1cc(C(=O)N2CCN(C(=O)/C=C/c3ccccc3)CC2Cc2c[nH]c3ccccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H27F3N4O2.ClH/c31-30(32,33)23-14-21(15-24(34)17-23)29(39)37-13-12-36(28(38)11-10-20-6-2-1-3-7-20)19-25(37)16-22-18-35-27-9-5-4-8-26(22)27;/h1-11,14-15,17-18,25,35H,12-13,16,19,34H2;1H/b11-10+; |
| InChIKey | VNKYHEXITBDPJE-ASTDGNLGSA-N |
| XLogP | 5.80 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.03 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|