C14H24O5 — CID 173306040
3-(3-hydroxy-2,2-dimethylpropoxy)carbonyl-2-methylhept-5-enoic acid (PubChem CID 173306040) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-(3-hydroxy-2,2-dimethylpropoxy)carbonyl-2-methylhept-5-enoic acid.
| Compound Name | 3-(3-hydroxy-2,2-dimethylpropoxy)carbonyl-2-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 173306040 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-(3-hydroxy-2,2-dimethylpropoxy)carbonyl-2-methylhept-5-enoic acid |
| SMILES | CC=CCC(C(=O)OCC(C)(C)CO)C(C)C(=O)O |
| InChI | InChI=1S/C14H24O5/c1-5-6-7-11(10(2)12(16)17)13(18)19-9-14(3,4)8-15/h5-6,10-11,15H,7-9H2,1-4H3,(H,16,17) |
| InChIKey | XZOOXDSLVVIZCU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|