C33H58O6PS+ — CID 173307149
[1-carboxy-2-(2-decoxypropoxy)-1-hydroxy-2-(3-phenylundecylsulfanyl)ethyl]-oxophosphanium (PubChem CID 173307149) has the molecular formula C33H58O6PS+ and a molecular weight of 613.86 g/mol. Its IUPAC name is [1-carboxy-2-(2-decoxypropoxy)-1-hydroxy-2-(3-phenylundecylsulfanyl)ethyl]-oxophosphanium.
| Compound Name | [1-carboxy-2-(2-decoxypropoxy)-1-hydroxy-2-(3-phenylundecylsulfanyl)ethyl]-oxophosphanium |
|---|---|
| PubChem CID | 173307149 |
| Molecular Formula | C33H58O6PS+ |
| Molecular Weight | 613.86 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | [1-carboxy-2-(2-decoxypropoxy)-1-hydroxy-2-(3-phenylundecylsulfanyl)ethyl]-oxophosphanium |
| SMILES | CCCCCCCCCCOC(C)COC(SCCC(CCCCCCCC)c1ccccc1)C(O)([PH+]=O)C(=O)O |
| InChI | InChI=1S/C33H57O6PS/c1-4-6-8-10-12-13-15-20-25-38-28(3)27-39-32(33(36,40-37)31(34)35)41-26-24-30(29-21-18-16-19-22-29)23-17-14-11-9-7-5-2/h16,18-19,21-22,28,30,32,36H,4-15,17,20,23-27H2,1-3H3,(H,34,35)/p+1 |
| InChIKey | MCNBNAUUNWZDIS-UHFFFAOYSA-O |
| XLogP | 9.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.86 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|