About cobalt;formaldehyde;triphenylphosphane
cobalt;formaldehyde;triphenylphosphane (PubChem CID 173310038) has the molecular formula C21H21CoO3P
and a molecular weight of 411.30 g/mol. Its IUPAC name is cobalt;formaldehyde;triphenylphosphane.
Molecular Properties
| Compound Name | cobalt;formaldehyde;triphenylphosphane |
| PubChem CID | 173310038 |
| Molecular Formula | C21H21CoO3P |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | cobalt;formaldehyde;triphenylphosphane |
| SMILES | C=O.C=O.C=O.[Co].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.3CH2O.Co/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-2;/h1-15H;3*1H2; |
| InChIKey | PJGDRBABHMBESX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cobalt;formaldehyde;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;formaldehyde;triphenylphosphane?
The IUPAC name of cobalt;formaldehyde;triphenylphosphane (CID 173310038) is cobalt;formaldehyde;triphenylphosphane.
What is the SMILES notation for cobalt;formaldehyde;triphenylphosphane?
The canonical SMILES for cobalt;formaldehyde;triphenylphosphane is C=O.C=O.C=O.[Co].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of cobalt;formaldehyde;triphenylphosphane?
The InChIKey is PJGDRBABHMBESX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.3CH2O.Co/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-2;/h1-15H;3*1H2;.
What are the key properties of cobalt;formaldehyde;triphenylphosphane?
cobalt;formaldehyde;triphenylphosphane has a molecular weight of 411.30 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;formaldehyde;triphenylphosphane is sourced from PubChem (CID 173310038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).