C16H23ClFN3 — CID 173310359
N-(3-chloro-4-fluorophenyl)-2-piperidin-4-ylpiperidin-4-amine (PubChem CID 173310359) has the molecular formula C16H23ClFN3 and a molecular weight of 311.83 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-piperidin-4-ylpiperidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-piperidin-4-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 173310359 |
| Molecular Formula | C16H23ClFN3 |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-piperidin-4-ylpiperidin-4-amine |
| SMILES | Fc1ccc(NC2CCNC(C3CCNCC3)C2)cc1Cl |
| InChI | InChI=1S/C16H23ClFN3/c17-14-9-12(1-2-15(14)18)21-13-5-8-20-16(10-13)11-3-6-19-7-4-11/h1-2,9,11,13,16,19-21H,3-8,10H2 |
| InChIKey | YGXUQZIYBONNFZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |