C24H23ClN2O3 — CID 173310860
(2S)-2-acetamido-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-3-naphthalen-2-ylpropanamide (PubChem CID 173310860) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-3-naphthalen-2-ylpropanamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 173310860 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-3-naphthalen-2-ylpropanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](C=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-16(29)26-23(14-18-6-9-19-4-2-3-5-20(19)12-18)24(30)27-22(15-28)13-17-7-10-21(25)11-8-17/h2-12,15,22-23H,13-14H2,1H3,(H,26,29)(H,27,30)/t22-,23-/m0/s1 |
| InChIKey | FOZZLCLKBXNIGQ-GOTSBHOMSA-N |
| XLogP | 3.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|