C21H25NSi — CID 173312745
N-tert-butyl-5-diphenylsilylcyclopenta-1,4-dien-1-amine (PubChem CID 173312745) has the molecular formula C21H25NSi and a molecular weight of 319.52 g/mol. Its IUPAC name is N-tert-butyl-5-diphenylsilylcyclopenta-1,4-dien-1-amine.
| Compound Name | N-tert-butyl-5-diphenylsilylcyclopenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 173312745 |
| Molecular Formula | C21H25NSi |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-tert-butyl-5-diphenylsilylcyclopenta-1,4-dien-1-amine |
| SMILES | CC(C)(C)NC1=CCC=C1[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NSi/c1-21(2,3)22-19-15-10-16-20(19)23(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-16,22-23H,10H2,1-3H3 |
| InChIKey | QYULGYJEULCVFV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|