C17H32F6O19P6S — CID 173312765
fluorophosphonic acid;[3-(4-methoxyphenyl)-2-propylphenyl]methanethiol (PubChem CID 173312765) has the molecular formula C17H32F6O19P6S and a molecular weight of 872.32 g/mol. Its IUPAC name is fluorophosphonic acid;[3-(4-methoxyphenyl)-2-propylphenyl]methanethiol.
| Compound Name | fluorophosphonic acid;[3-(4-methoxyphenyl)-2-propylphenyl]methanethiol |
|---|---|
| PubChem CID | 173312765 |
| Molecular Formula | C17H32F6O19P6S |
| Molecular Weight | 872.32 g/mol |
| Exact Mass | 871.96 |
| IUPAC Name | fluorophosphonic acid;[3-(4-methoxyphenyl)-2-propylphenyl]methanethiol |
| SMILES | CCCc1c(CS)cccc1-c1ccc(OC)cc1.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F |
| InChI | InChI=1S/C17H20OS.6FH2O3P/c1-3-5-16-14(12-19)6-4-7-17(16)13-8-10-15(18-2)11-9-13;6*1-5(2,3)4/h4,6-11,19H,3,5,12H2,1-2H3;6*(H2,2,3,4) |
| InChIKey | JMGWTGZCWYERIM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 354.41 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|