About ethenyl(silyloxy)silane
ethenyl(silyloxy)silane (PubChem CID 173316736) has the molecular formula C6H24O3Si6
and a molecular weight of 312.77 g/mol. Its IUPAC name is ethenyl(silyloxy)silane.
Molecular Properties
| Compound Name | ethenyl(silyloxy)silane |
| PubChem CID | 173316736 |
| Molecular Formula | C6H24O3Si6 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | ethenyl(silyloxy)silane |
| SMILES | C=C[SiH2]O[SiH3].C=C[SiH2]O[SiH3].C=C[SiH2]O[SiH3] |
| InChI | InChI=1S/3C2H8OSi2/c3*1-2-5-3-4/h3*2H,1,5H2,4H3 |
| InChIKey | JKXJWZKRSHUVAI-UHFFFAOYSA-N |
| XLogP | -4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(silyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(silyloxy)silane?
The IUPAC name of ethenyl(silyloxy)silane (CID 173316736) is ethenyl(silyloxy)silane.
What is the SMILES notation for ethenyl(silyloxy)silane?
The canonical SMILES for ethenyl(silyloxy)silane is C=C[SiH2]O[SiH3].C=C[SiH2]O[SiH3].C=C[SiH2]O[SiH3].
What is the InChIKey of ethenyl(silyloxy)silane?
The InChIKey is JKXJWZKRSHUVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/3C2H8OSi2/c3*1-2-5-3-4/h3*2H,1,5H2,4H3.
What are the key properties of ethenyl(silyloxy)silane?
ethenyl(silyloxy)silane has a molecular weight of 312.77 g/mol, XLogP of -4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(silyloxy)silane is sourced from PubChem (CID 173316736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).