About buta-1,3-diene;platinum;silyloxysilane
buta-1,3-diene;platinum;silyloxysilane (PubChem CID 173106577) has the molecular formula C4H12OPtSi2
and a molecular weight of 327.39 g/mol. Its IUPAC name is buta-1,3-diene;platinum;silyloxysilane.
Molecular Properties
| Compound Name | buta-1,3-diene;platinum;silyloxysilane |
| PubChem CID | 173106577 |
| Molecular Formula | C4H12OPtSi2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | buta-1,3-diene;platinum;silyloxysilane |
| SMILES | C=CC=C.[Pt].[SiH3]O[SiH3] |
| InChI | InChI=1S/C4H6.H6OSi2.Pt/c1-3-4-2;2-1-3;/h3-4H,1-2H2;2-3H3; |
| InChIKey | QIQCUAMHCIUPSP-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;platinum;silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;platinum;silyloxysilane?
The IUPAC name of buta-1,3-diene;platinum;silyloxysilane (CID 173106577) is buta-1,3-diene;platinum;silyloxysilane.
What is the SMILES notation for buta-1,3-diene;platinum;silyloxysilane?
The canonical SMILES for buta-1,3-diene;platinum;silyloxysilane is C=CC=C.[Pt].[SiH3]O[SiH3].
What is the InChIKey of buta-1,3-diene;platinum;silyloxysilane?
The InChIKey is QIQCUAMHCIUPSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6.H6OSi2.Pt/c1-3-4-2;2-1-3;/h3-4H,1-2H2;2-3H3;.
What are the key properties of buta-1,3-diene;platinum;silyloxysilane?
buta-1,3-diene;platinum;silyloxysilane has a molecular weight of 327.39 g/mol, XLogP of -1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;platinum;silyloxysilane is sourced from PubChem (CID 173106577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).