C26H44N2O2 — CID 173317038
(3S,5R,8S,9S,10S,13S,14S)-3-[3-(4-aminobutoxyimino)prop-1-enyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 173317038) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is (3S,5R,8S,9S,10S,13S,14S)-3-[3-(4-aminobutoxyimino)prop-1-enyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,8S,9S,10S,13S,14S)-3-[3-(4-aminobutoxyimino)prop-1-enyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 173317038 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | (3S,5R,8S,9S,10S,13S,14S)-3-[3-(4-aminobutoxyimino)prop-1-enyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@@H]3C[C@](O)(C=CC=NOCCCCN)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C26H44N2O2/c1-24-11-5-7-22(24)21-9-8-20-19-26(29,12-6-17-28-30-18-4-3-16-27)15-14-25(20,2)23(21)10-13-24/h6,12,17,20-23,29H,3-5,7-11,13-16,18-19,27H2,1-2H3/t20-,21+,22+,23+,24+,25+,26+/m1/s1 |
| InChIKey | UXTCBMMEPFEFRZ-JXFGHYCFSA-N |
| XLogP | 5.45 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|