C24H42N4O2 — CID 176519302
1-[2-[2-[(3R,5R,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]ethylideneamino]oxyethyl]guanidine (PubChem CID 176519302) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-[2-[2-[(3R,5R,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]ethylideneamino]oxyethyl]guanidine.
| Compound Name | 1-[2-[2-[(3R,5R,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]ethylideneamino]oxyethyl]guanidine |
|---|---|
| PubChem CID | 176519302 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 1-[2-[2-[(3R,5R,8S,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]ethylideneamino]oxyethyl]guanidine |
| SMILES | [H]/N=C(\N)NCCON=CCC1C[C@@]2(C)[C@H](CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]32)C[C@H]1O |
| InChI | InChI=1S/C24H42N4O2/c1-23-9-3-4-19(23)18-6-5-17-14-21(29)16(15-24(17,2)20(18)7-10-23)8-11-28-30-13-12-27-22(25)26/h11,16-21,29H,3-10,12-15H2,1-2H3,(H4,25,26,27)/t16?,17-,18+,19+,20+,21-,23+,24+/m1/s1 |
| InChIKey | IBBZANQFDIXIIV-MSCNJTRMSA-N |
| XLogP | 3.88 |
| TPSA | 103.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|