C22H35Cl — CID 70572439
(2R,5S,8S,9S,10S,13S,14S)-3-chloro-10,13-dimethyl-2-prop-2-enyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 70572439) has the molecular formula C22H35Cl and a molecular weight of 334.98 g/mol. Its IUPAC name is (2R,5S,8S,9S,10S,13S,14S)-3-chloro-10,13-dimethyl-2-prop-2-enyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (2R,5S,8S,9S,10S,13S,14S)-3-chloro-10,13-dimethyl-2-prop-2-enyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 70572439 |
| Molecular Formula | C22H35Cl |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2R,5S,8S,9S,10S,13S,14S)-3-chloro-10,13-dimethyl-2-prop-2-enyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=CC[C@@H]1C[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]32)CC1Cl |
| InChI | InChI=1S/C22H35Cl/c1-4-6-15-14-22(3)16(13-20(15)23)8-9-17-18-7-5-11-21(18,2)12-10-19(17)22/h4,15-20H,1,5-14H2,2-3H3/t15-,16+,17+,18+,19+,20?,21+,22+/m1/s1 |
| InChIKey | OMIXYTKCEXBXDQ-COMGZXESSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|