C24H42O3 — CID 90853584
(8S,9R,10S,13S,14S)-2-(hydroxymethyl)-10,13-dimethyl-3-(propoxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 90853584) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-2-(hydroxymethyl)-10,13-dimethyl-3-(propoxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9R,10S,13S,14S)-2-(hydroxymethyl)-10,13-dimethyl-3-(propoxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 90853584 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | (8S,9R,10S,13S,14S)-2-(hydroxymethyl)-10,13-dimethyl-3-(propoxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCCOCC1(O)CC2CC[C@@H]3[C@@H](CC[C@]4(C)CCC[C@@H]34)[C@@]2(C)CC1CO |
| InChI | InChI=1S/C24H42O3/c1-4-12-27-16-24(26)14-17-7-8-19-20-6-5-10-22(20,2)11-9-21(19)23(17,3)13-18(24)15-25/h17-21,25-26H,4-16H2,1-3H3/t17?,18?,19-,20-,21+,22-,23-,24?/m0/s1 |
| InChIKey | KJLSCTQTXVFBNX-UXRCYEFJSA-N |
| XLogP | 4.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|