C15H18ClNO — CID 173320285
(8S)-8-(4-chlorophenyl)-1,2,3,5,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-one (PubChem CID 173320285) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is (8S)-8-(4-chlorophenyl)-1,2,3,5,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-one.
| Compound Name | (8S)-8-(4-chlorophenyl)-1,2,3,5,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-one |
|---|---|
| PubChem CID | 173320285 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (8S)-8-(4-chlorophenyl)-1,2,3,5,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-one |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2)CC2CCCN2C1 |
| InChI | InChI=1S/C15H18ClNO/c16-13-5-3-11(4-6-13)12-8-14-2-1-7-17(14)10-15(18)9-12/h3-6,12,14H,1-2,7-10H2/t12-,14?/m0/s1 |
| InChIKey | GOXSOKNJHICDHJ-NBFOIZRFSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |