C15H24O3Si — CID 173322451
4-[(4-ethenylphenyl)methoxy]butyl-dimethoxysilane (PubChem CID 173322451) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is 4-[(4-ethenylphenyl)methoxy]butyl-dimethoxysilane.
| Compound Name | 4-[(4-ethenylphenyl)methoxy]butyl-dimethoxysilane |
|---|---|
| PubChem CID | 173322451 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 4-[(4-ethenylphenyl)methoxy]butyl-dimethoxysilane |
| SMILES | C=Cc1ccc(COCCCC[SiH](OC)OC)cc1 |
| InChI | InChI=1S/C15H24O3Si/c1-4-14-7-9-15(10-8-14)13-18-11-5-6-12-19(16-2)17-3/h4,7-10,19H,1,5-6,11-13H2,2-3H3 |
| InChIKey | BDMKYZKWKWSNMB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|