About 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene
2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene (PubChem CID 173323339) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene |
| PubChem CID | 173323339 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene |
| SMILES | CN(C)c1ccc(OC(=O)C(=O)O)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO4.C7H8/c1-11(2)7-3-5-8(6-4-7)15-10(14)9(12)13;1-7-5-3-2-4-6-7/h3-6H,1-2H3,(H,12,13);2-6H,1H3 |
| InChIKey | NACCCWPUKKKBSC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene?
The IUPAC name of 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene (CID 173323339) is 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene.
What is the SMILES notation for 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene?
The canonical SMILES for 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene is CN(C)c1ccc(OC(=O)C(=O)O)cc1.Cc1ccccc1.
What is the InChIKey of 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene?
The InChIKey is NACCCWPUKKKBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C7H8/c1-11(2)7-3-5-8(6-4-7)15-10(14)9(12)13;1-7-5-3-2-4-6-7/h3-6H,1-2H3,(H,12,13);2-6H,1H3.
What are the key properties of 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene?
2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene has a molecular weight of 301.34 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenoxy]-2-oxoacetic acid;toluene is sourced from PubChem (CID 173323339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).