C12H17NO3S2 — CID 173323935
N-(4-methylsulfanyl-1-oxobutan-2-yl)-1-phenylmethanesulfonamide (PubChem CID 173323935) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(4-methylsulfanyl-1-oxobutan-2-yl)-1-phenylmethanesulfonamide.
| Compound Name | N-(4-methylsulfanyl-1-oxobutan-2-yl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 173323935 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(4-methylsulfanyl-1-oxobutan-2-yl)-1-phenylmethanesulfonamide |
| SMILES | CSCCC(C=O)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO3S2/c1-17-8-7-12(9-14)13-18(15,16)10-11-5-3-2-4-6-11/h2-6,9,12-13H,7-8,10H2,1H3 |
| InChIKey | PXXFZABDCQCWMO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|