About 4-but-3-enoylheptanedial
4-but-3-enoylheptanedial (PubChem CID 173325048) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-but-3-enoylheptanedial.
Molecular Properties
| Compound Name | 4-but-3-enoylheptanedial |
| PubChem CID | 173325048 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4-but-3-enoylheptanedial |
| SMILES | C=CCC(=O)C(CCC=O)CCC=O |
| InChI | InChI=1S/C11H16O3/c1-2-5-11(14)10(6-3-8-12)7-4-9-13/h2,8-10H,1,3-7H2 |
| InChIKey | RTBBQACVVXFOEM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enoylheptanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enoylheptanedial?
The IUPAC name of 4-but-3-enoylheptanedial (CID 173325048) is 4-but-3-enoylheptanedial.
What is the SMILES notation for 4-but-3-enoylheptanedial?
The canonical SMILES for 4-but-3-enoylheptanedial is C=CCC(=O)C(CCC=O)CCC=O.
What is the InChIKey of 4-but-3-enoylheptanedial?
The InChIKey is RTBBQACVVXFOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-2-5-11(14)10(6-3-8-12)7-4-9-13/h2,8-10H,1,3-7H2.
What are the key properties of 4-but-3-enoylheptanedial?
4-but-3-enoylheptanedial has a molecular weight of 196.25 g/mol, XLogP of 1.71, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enoylheptanedial is sourced from PubChem (CID 173325048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).