C24H21N6O5S2+ — CID 173326252
7-[[2-(2-amino-1,3-thiazol-4-yl)-2-phenoxyiminoacetyl]amino]-3-(1-methylpyridin-1-ium-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 173326252) has the molecular formula C24H21N6O5S2+ and a molecular weight of 537.60 g/mol. Its IUPAC name is 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-phenoxyiminoacetyl]amino]-3-(1-methylpyridin-1-ium-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-phenoxyiminoacetyl]amino]-3-(1-methylpyridin-1-ium-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 173326252 |
| Molecular Formula | C24H21N6O5S2+ |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-phenoxyiminoacetyl]amino]-3-(1-methylpyridin-1-ium-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C[n+]1ccccc1C1=C(C(=O)O)N2C(=O)C(NC(=O)C(=NOc3ccccc3)c3csc(N)n3)C2CS1 |
| InChI | InChI=1S/C24H20N6O5S2/c1-29-10-6-5-9-15(29)20-19(23(33)34)30-16(12-36-20)18(22(30)32)27-21(31)17(14-11-37-24(25)26-14)28-35-13-7-3-2-4-8-13/h2-11,16,18H,12H2,1H3,(H3-,25,26,27,31,33,34)/p+1 |
| InChIKey | OIXVESGFZHGUEJ-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|