C23H44O5 — CID 173327696
(1-hydroxy-3-octadec-9-enylperoxypropan-2-yl) acetate (PubChem CID 173327696) has the molecular formula C23H44O5 and a molecular weight of 400.60 g/mol. Its IUPAC name is (1-hydroxy-3-octadec-9-enylperoxypropan-2-yl) acetate.
| Compound Name | (1-hydroxy-3-octadec-9-enylperoxypropan-2-yl) acetate |
|---|---|
| PubChem CID | 173327696 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | (1-hydroxy-3-octadec-9-enylperoxypropan-2-yl) acetate |
| SMILES | CCCCCCCCC=CCCCCCCCCOOCC(CO)OC(C)=O |
| InChI | InChI=1S/C23H44O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-27-21-23(20-24)28-22(2)25/h10-11,23-24H,3-9,12-21H2,1-2H3 |
| InChIKey | CEGNVNDDBLHPBO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|