C23H21ClFN7O5S3 — CID 173328004
(6R,7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetyl]amino]-8-oxo-3-(2-phenylpyrazol-3-yl)sulfanyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173328004) has the molecular formula C23H21ClFN7O5S3 and a molecular weight of 626.12 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetyl]amino]-8-oxo-3-(2-phenylpyrazol-3-yl)sulfanyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R,7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetyl]amino]-8-oxo-3-(2-phenylpyrazol-3-yl)sulfanyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173328004 |
| Molecular Formula | C23H21ClFN7O5S3 |
| Molecular Weight | 626.12 g/mol |
| Exact Mass | 625.04 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetyl]amino]-8-oxo-3-(2-phenylpyrazol-3-yl)sulfanyl-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | Nc1nc(C(=NOCCF)C(=O)N[C@@H]2C(=O)N3CC(Sc4ccnn4-c4ccccc4)(C(=O)O)CS[C@H]23)c(Cl)s1 |
| InChI | InChI=1S/C23H21ClFN7O5S3/c24-17-14(29-22(26)39-17)15(30-37-9-7-25)18(33)28-16-19(34)31-10-23(21(35)36,11-38-20(16)31)40-13-6-8-27-32(13)12-4-2-1-3-5-12/h1-6,8,16,20H,7,9-11H2,(H2,26,29)(H,28,33)(H,35,36)/t16-,20-,23?/m1/s1 |
| InChIKey | HMTYIVRSMHDLFI-OQPCWVPASA-N |
| XLogP | 2.27 |
| TPSA | 165.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|