C24H23FNO5P — CID 173328220
4-(4-fluorophenyl)-2,3-dihydroxy-7-methyl-2-phosphoroso-3-quinolin-2-yloct-5-enoic acid (PubChem CID 173328220) has the molecular formula C24H23FNO5P and a molecular weight of 455.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,3-dihydroxy-7-methyl-2-phosphoroso-3-quinolin-2-yloct-5-enoic acid.
| Compound Name | 4-(4-fluorophenyl)-2,3-dihydroxy-7-methyl-2-phosphoroso-3-quinolin-2-yloct-5-enoic acid |
|---|---|
| PubChem CID | 173328220 |
| Molecular Formula | C24H23FNO5P |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-(4-fluorophenyl)-2,3-dihydroxy-7-methyl-2-phosphoroso-3-quinolin-2-yloct-5-enoic acid |
| SMILES | CC(C)C=CC(c1ccc(F)cc1)C(O)(c1ccc2ccccc2n1)C(O)(P=O)C(=O)O |
| InChI | InChI=1S/C24H23FNO5P/c1-15(2)7-13-19(16-8-11-18(25)12-9-16)23(29,24(30,32-31)22(27)28)21-14-10-17-5-3-4-6-20(17)26-21/h3-15,19,29-30H,1-2H3,(H,27,28) |
| InChIKey | BUABYGGUGLPNBY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|