C24H22FNO5P+ — CID 67714754
[3-carboxy-1-(4-fluorophenyl)-4-hydroxy-6-methyl-4-quinolin-2-ylhept-1-yn-3-yl]-hydroxy-oxophosphanium (PubChem CID 67714754) has the molecular formula C24H22FNO5P+ and a molecular weight of 454.41 g/mol. Its IUPAC name is [3-carboxy-1-(4-fluorophenyl)-4-hydroxy-6-methyl-4-quinolin-2-ylhept-1-yn-3-yl]-hydroxy-oxophosphanium.
| Compound Name | [3-carboxy-1-(4-fluorophenyl)-4-hydroxy-6-methyl-4-quinolin-2-ylhept-1-yn-3-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67714754 |
| Molecular Formula | C24H22FNO5P+ |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [3-carboxy-1-(4-fluorophenyl)-4-hydroxy-6-methyl-4-quinolin-2-ylhept-1-yn-3-yl]-hydroxy-oxophosphanium |
| SMILES | CC(C)CC(O)(c1ccc2ccccc2n1)C(C#Cc1ccc(F)cc1)(C(=O)O)[P+](=O)O |
| InChI | InChI=1S/C24H21FNO5P/c1-16(2)15-23(29,21-12-9-18-5-3-4-6-20(18)26-21)24(22(27)28,32(30)31)14-13-17-7-10-19(25)11-8-17/h3-12,16,29H,15H2,1-2H3,(H-,27,28,30,31)/p+1 |
| InChIKey | JDFGSIDCJNNEAE-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|