C29H30FNO5P+ — CID 67714642
[3-carboxy-2-(5-ethyl-6-phenyl-2-pyridinyl)-1-(4-fluorophenyl)-2-hydroxy-6-methylhept-4-yn-3-yl]-methoxy-oxophosphanium (PubChem CID 67714642) has the molecular formula C29H30FNO5P+ and a molecular weight of 522.53 g/mol. Its IUPAC name is [3-carboxy-2-(5-ethyl-6-phenyl-2-pyridinyl)-1-(4-fluorophenyl)-2-hydroxy-6-methylhept-4-yn-3-yl]-methoxy-oxophosphanium.
| Compound Name | [3-carboxy-2-(5-ethyl-6-phenyl-2-pyridinyl)-1-(4-fluorophenyl)-2-hydroxy-6-methylhept-4-yn-3-yl]-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 67714642 |
| Molecular Formula | C29H30FNO5P+ |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [3-carboxy-2-(5-ethyl-6-phenyl-2-pyridinyl)-1-(4-fluorophenyl)-2-hydroxy-6-methylhept-4-yn-3-yl]-methoxy-oxophosphanium |
| SMILES | CCc1ccc(C(O)(Cc2ccc(F)cc2)C(C#CC(C)C)(C(=O)O)[P+](=O)OC)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H29FNO5P/c1-5-22-13-16-25(31-26(22)23-9-7-6-8-10-23)28(34,19-21-11-14-24(30)15-12-21)29(27(32)33,37(35)36-4)18-17-20(2)3/h6-16,20,34H,5,19H2,1-4H3/p+1 |
| InChIKey | QACKNKZSTBYYTD-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|